C13H20O2 — CID 158261825
4,5-dimethyl-1,3-dioxolane;1,2-xylene (PubChem CID 158261825) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-dioxolane;1,2-xylene.
| Compound Name | 4,5-dimethyl-1,3-dioxolane;1,2-xylene |
|---|---|
| PubChem CID | 158261825 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4,5-dimethyl-1,3-dioxolane;1,2-xylene |
| SMILES | CC1OCOC1C.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C5H10O2/c1-7-5-3-4-6-8(7)2;1-4-5(2)7-3-6-4/h3-6H,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | GHYPGLBUVDIAEY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |