C10H18O2 — CID 143261797
ethane;4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-dioxolane (PubChem CID 143261797) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is ethane;4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-dioxolane.
| Compound Name | ethane;4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 143261797 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | ethane;4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-dioxolane |
| SMILES | C=CC1OCOC1/C=C\C.CC |
| InChI | InChI=1S/C8H12O2.C2H6/c1-3-5-8-7(4-2)9-6-10-8;1-2/h3-5,7-8H,2,6H2,1H3;1-2H3/b5-3-; |
| InChIKey | SPPXRYNCQWEXPS-FBZPGIPVSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|