C11H20O2 — CID 143329167
4-butan-2-yl-5-ethenyl-1,3-dioxolane;ethene (PubChem CID 143329167) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-butan-2-yl-5-ethenyl-1,3-dioxolane;ethene.
| Compound Name | 4-butan-2-yl-5-ethenyl-1,3-dioxolane;ethene |
|---|---|
| PubChem CID | 143329167 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4-butan-2-yl-5-ethenyl-1,3-dioxolane;ethene |
| SMILES | C=C.C=CC1OCOC1C(C)CC |
| InChI | InChI=1S/C9H16O2.C2H4/c1-4-7(3)9-8(5-2)10-6-11-9;1-2/h5,7-9H,2,4,6H2,1,3H3;1-2H2 |
| InChIKey | OJRNHCWIBYOYEO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|