About 2-butan-2-yloxirane;methane
2-butan-2-yloxirane;methane (PubChem CID 161408982) has the molecular formula C8H20O
and a molecular weight of 132.25 g/mol. Its IUPAC name is 2-butan-2-yloxirane;methane.
Molecular Properties
| Compound Name | 2-butan-2-yloxirane;methane |
| PubChem CID | 161408982 |
| Molecular Formula | C8H20O |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.15 |
| IUPAC Name | 2-butan-2-yloxirane;methane |
| SMILES | C.C.CCC(C)C1CO1 |
| InChI | InChI=1S/C6H12O.2CH4/c1-3-5(2)6-4-7-6;;/h5-6H,3-4H2,1-2H3;2*1H4 |
| InChIKey | VVFKWFLTGYBDCX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yloxirane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxirane;methane?
The IUPAC name of 2-butan-2-yloxirane;methane (CID 161408982) is 2-butan-2-yloxirane;methane.
What is the SMILES notation for 2-butan-2-yloxirane;methane?
The canonical SMILES for 2-butan-2-yloxirane;methane is C.C.CCC(C)C1CO1.
What is the InChIKey of 2-butan-2-yloxirane;methane?
The InChIKey is VVFKWFLTGYBDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.2CH4/c1-3-5(2)6-4-7-6;;/h5-6H,3-4H2,1-2H3;2*1H4.
What are the key properties of 2-butan-2-yloxirane;methane?
2-butan-2-yloxirane;methane has a molecular weight of 132.25 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxirane;methane is sourced from PubChem (CID 161408982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).