C7H14O2 — CID 175884544
(2R,3S)-2-[(2R)-oxiran-2-yl]pentan-3-ol (PubChem CID 175884544) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R,3S)-2-[(2R)-oxiran-2-yl]pentan-3-ol.
| Compound Name | (2R,3S)-2-[(2R)-oxiran-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 175884544 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2R,3S)-2-[(2R)-oxiran-2-yl]pentan-3-ol |
| SMILES | CC[C@H](O)[C@@H](C)[C@@H]1CO1 |
| InChI | InChI=1S/C7H14O2/c1-3-6(8)5(2)7-4-9-7/h5-8H,3-4H2,1-2H3/t5-,6+,7+/m1/s1 |
| InChIKey | ZJQHIAYVZIQRNG-VQVTYTSYSA-N |
| XLogP | 0.79 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|