C7H14O3 — CID 130928747
(1S,2R)-3-methyl-1-[(2S)-oxiran-2-yl]butane-1,2-diol (PubChem CID 130928747) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (1S,2R)-3-methyl-1-[(2S)-oxiran-2-yl]butane-1,2-diol.
| Compound Name | (1S,2R)-3-methyl-1-[(2S)-oxiran-2-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 130928747 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1S,2R)-3-methyl-1-[(2S)-oxiran-2-yl]butane-1,2-diol |
| SMILES | CC(C)[C@@H](O)[C@H](O)[C@@H]1CO1 |
| InChI | InChI=1S/C7H14O3/c1-4(2)6(8)7(9)5-3-10-5/h4-9H,3H2,1-2H3/t5-,6+,7+/m0/s1 |
| InChIKey | MPIRGCDKHIWFSS-RRKCRQDMSA-N |
| XLogP | -0.24 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|