About butan-2-ol;2-methyloxirane
butan-2-ol;2-methyloxirane (PubChem CID 161079441) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is butan-2-ol;2-methyloxirane.
Molecular Properties
| Compound Name | butan-2-ol;2-methyloxirane |
| PubChem CID | 161079441 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | butan-2-ol;2-methyloxirane |
| SMILES | CC1CO1.CCC(C)O |
| InChI | InChI=1S/C4H10O.C3H6O/c1-3-4(2)5;1-3-2-4-3/h4-5H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | UFSHESWZZNEOCO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;2-methyloxirane?
The IUPAC name of butan-2-ol;2-methyloxirane (CID 161079441) is butan-2-ol;2-methyloxirane.
What is the SMILES notation for butan-2-ol;2-methyloxirane?
The canonical SMILES for butan-2-ol;2-methyloxirane is CC1CO1.CCC(C)O.
What is the InChIKey of butan-2-ol;2-methyloxirane?
The InChIKey is UFSHESWZZNEOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C3H6O/c1-3-4(2)5;1-3-2-4-3/h4-5H,3H2,1-2H3;3H,2H2,1H3.
What are the key properties of butan-2-ol;2-methyloxirane?
butan-2-ol;2-methyloxirane has a molecular weight of 132.20 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;2-methyloxirane is sourced from PubChem (CID 161079441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).