About ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane
ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane (PubChem CID 161310454) has the molecular formula C10H26N2O2
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane.
Molecular Properties
| Compound Name | ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane |
| PubChem CID | 161310454 |
| Molecular Formula | C10H26N2O2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane |
| SMILES | CC1CO1.CCN.CCNCC(C)O |
| InChI | InChI=1S/C5H13NO.C3H6O.C2H7N/c1-3-6-4-5(2)7;1-3-2-4-3;1-2-3/h5-7H,3-4H2,1-2H3;3H,2H2,1H3;2-3H2,1H3 |
| InChIKey | VIUVJJGPWBTWCJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane?
The IUPAC name of ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane (CID 161310454) is ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane.
What is the SMILES notation for ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane?
The canonical SMILES for ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane is CC1CO1.CCN.CCNCC(C)O.
What is the InChIKey of ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane?
The InChIKey is VIUVJJGPWBTWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO.C3H6O.C2H7N/c1-3-6-4-5(2)7;1-3-2-4-3;1-2-3/h5-7H,3-4H2,1-2H3;3H,2H2,1H3;2-3H2,1H3.
What are the key properties of ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane?
ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane has a molecular weight of 206.33 g/mol, XLogP of 0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1-(ethylamino)propan-2-ol;2-methyloxirane is sourced from PubChem (CID 161310454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).