About methanamine;2-methyloxirane;pentan-2-ol
methanamine;2-methyloxirane;pentan-2-ol (PubChem CID 159958720) has the molecular formula C9H23NO2
and a molecular weight of 177.29 g/mol. Its IUPAC name is methanamine;2-methyloxirane;pentan-2-ol.
Molecular Properties
| Compound Name | methanamine;2-methyloxirane;pentan-2-ol |
| PubChem CID | 159958720 |
| Molecular Formula | C9H23NO2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.17 |
| IUPAC Name | methanamine;2-methyloxirane;pentan-2-ol |
| SMILES | CC1CO1.CCCC(C)O.CN |
| InChI | InChI=1S/C5H12O.C3H6O.CH5N/c1-3-4-5(2)6;1-3-2-4-3;1-2/h5-6H,3-4H2,1-2H3;3H,2H2,1H3;2H2,1H3 |
| InChIKey | ODAVNUYKMRAMIC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-methyloxirane;pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methyloxirane;pentan-2-ol?
The IUPAC name of methanamine;2-methyloxirane;pentan-2-ol (CID 159958720) is methanamine;2-methyloxirane;pentan-2-ol.
What is the SMILES notation for methanamine;2-methyloxirane;pentan-2-ol?
The canonical SMILES for methanamine;2-methyloxirane;pentan-2-ol is CC1CO1.CCCC(C)O.CN.
What is the InChIKey of methanamine;2-methyloxirane;pentan-2-ol?
The InChIKey is ODAVNUYKMRAMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C3H6O.CH5N/c1-3-4-5(2)6;1-3-2-4-3;1-2/h5-6H,3-4H2,1-2H3;3H,2H2,1H3;2H2,1H3.
What are the key properties of methanamine;2-methyloxirane;pentan-2-ol?
methanamine;2-methyloxirane;pentan-2-ol has a molecular weight of 177.29 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methyloxirane;pentan-2-ol is sourced from PubChem (CID 159958720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).