About butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane
butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane (PubChem CID 19898407) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane.
Molecular Properties
| Compound Name | butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane |
| PubChem CID | 19898407 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane |
| SMILES | C(CC1CO1)C1CO1.CCCC(O)O |
| InChI | InChI=1S/C6H10O2.C4H10O2/c1(5-3-7-5)2-6-4-8-6;1-2-3-4(5)6/h5-6H,1-4H2;4-6H,2-3H2,1H3 |
| InChIKey | UAIWCWPUMWHIQS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane?
The IUPAC name of butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane (CID 19898407) is butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane.
What is the SMILES notation for butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane?
The canonical SMILES for butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane is C(CC1CO1)C1CO1.CCCC(O)O.
What is the InChIKey of butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane?
The InChIKey is UAIWCWPUMWHIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C4H10O2/c1(5-3-7-5)2-6-4-8-6;1-2-3-4(5)6/h5-6H,1-4H2;4-6H,2-3H2,1H3.
What are the key properties of butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane?
butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane has a molecular weight of 204.27 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diol;2-[2-(oxiran-2-yl)ethyl]oxirane is sourced from PubChem (CID 19898407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).