C13H28O3 — CID 160991643
1,7-bis(oxiran-2-yl)heptan-4-ol;methane (PubChem CID 160991643) has the molecular formula C13H28O3 and a molecular weight of 232.36 g/mol. Its IUPAC name is 1,7-bis(oxiran-2-yl)heptan-4-ol;methane.
| Compound Name | 1,7-bis(oxiran-2-yl)heptan-4-ol;methane |
|---|---|
| PubChem CID | 160991643 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1,7-bis(oxiran-2-yl)heptan-4-ol;methane |
| SMILES | C.C.OC(CCCC1CO1)CCCC1CO1 |
| InChI | InChI=1S/C11H20O3.2CH4/c12-9(3-1-5-10-7-13-10)4-2-6-11-8-14-11;;/h9-12H,1-8H2;2*1H4 |
| InChIKey | TUSAGQYMGBKIFO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|