C16H34O5 — CID 174766235
butane;hexane-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174766235) has the molecular formula C16H34O5 and a molecular weight of 306.44 g/mol. Its IUPAC name is butane;hexane-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | butane;hexane-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174766235 |
| Molecular Formula | C16H34O5 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | butane;hexane-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCC(O)CCCO.CCCC |
| InChI | InChI=1S/C6H10O3.C6H14O2.C4H10/c1(5-3-8-5)7-2-6-4-9-6;1-2-6(8)4-3-5-7;1-3-4-2/h5-6H,1-4H2;6-8H,2-5H2,1H3;3-4H2,1-2H3 |
| InChIKey | KFHRFUHWWTZQSW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|