C14H30O5 — CID 174940930
2-(5-methylheptoxymethyl)oxirane;propane-1,2,3-triol (PubChem CID 174940930) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-(5-methylheptoxymethyl)oxirane;propane-1,2,3-triol.
| Compound Name | 2-(5-methylheptoxymethyl)oxirane;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174940930 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-(5-methylheptoxymethyl)oxirane;propane-1,2,3-triol |
| SMILES | CCC(C)CCCCOCC1CO1.OCC(O)CO |
| InChI | InChI=1S/C11H22O2.C3H8O3/c1-3-10(2)6-4-5-7-12-8-11-9-13-11;4-1-3(6)2-5/h10-11H,3-9H2,1-2H3;3-6H,1-2H2 |
| InChIKey | HGXSMPWKTBBZBL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|