About 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane
2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 130365137) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 130365137 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCCCC1CO1 |
| InChI | InChI=1S/C6H10O3.C6H12O/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-4-6-5-7-6/h5-6H,1-4H2;6H,2-5H2,1H3 |
| InChIKey | FDSZTUPDIDOQRA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 130365137) is 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CCCCC1CO1.
What is the InChIKey of 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is FDSZTUPDIDOQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H12O/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-4-6-5-7-6/h5-6H,1-4H2;6H,2-5H2,1H3.
What are the key properties of 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane?
2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 230.30 g/mol, XLogP of 1.38, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyloxirane;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 130365137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).