C13H28O6 — CID 146198033
ethoxyethane;2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2-diol (PubChem CID 146198033) has the molecular formula C13H28O6 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethoxyethane;2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2-diol.
| Compound Name | ethoxyethane;2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2-diol |
|---|---|
| PubChem CID | 146198033 |
| Molecular Formula | C13H28O6 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | ethoxyethane;2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2-diol |
| SMILES | C(OCC1CO1)C1CO1.CC(O)CO.CCOCC |
| InChI | InChI=1S/C6H10O3.C4H10O.C3H8O2/c1(5-3-8-5)7-2-6-4-9-6;1-3-5-4-2;1-3(5)2-4/h5-6H,1-4H2;3-4H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | RHLSANNVKDFLCH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|