About 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol
1,9-bis(1,3-dioxol-2-yl)nonan-5-ol (PubChem CID 169084555) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol.
Molecular Properties
| Compound Name | 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol |
| PubChem CID | 169084555 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol |
| SMILES | OC(CCCCC1OC=CO1)CCCCC1OC=CO1 |
| InChI | InChI=1S/C15H24O5/c16-13(5-1-3-7-14-17-9-10-18-14)6-2-4-8-15-19-11-12-20-15/h9-16H,1-8H2 |
| InChIKey | RKXCHZUXDGMOSX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol?
The IUPAC name of 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol (CID 169084555) is 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol.
What is the SMILES notation for 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol?
The canonical SMILES for 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol is OC(CCCCC1OC=CO1)CCCCC1OC=CO1.
What is the InChIKey of 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol?
The InChIKey is RKXCHZUXDGMOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O5/c16-13(5-1-3-7-14-17-9-10-18-14)6-2-4-8-15-19-11-12-20-15/h9-16H,1-8H2.
What are the key properties of 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol?
1,9-bis(1,3-dioxol-2-yl)nonan-5-ol has a molecular weight of 284.35 g/mol, XLogP of 3.16, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol is sourced from PubChem (CID 169084555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).