C15H24O5 — CID 169084555
1,9-bis(1,3-dioxol-2-yl)nonan-5-ol (PubChem CID 169084555) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol.
| Compound Name | 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol |
|---|---|
| PubChem CID | 169084555 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,9-bis(1,3-dioxol-2-yl)nonan-5-ol |
| SMILES | OC(CCCCC1OC=CO1)CCCCC1OC=CO1 |
| InChI | InChI=1S/C15H24O5/c16-13(5-1-3-7-14-17-9-10-18-14)6-2-4-8-15-19-11-12-20-15/h9-16H,1-8H2 |
| InChIKey | RKXCHZUXDGMOSX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|