C9H22O5 — CID 159169454
bis(2-methyloxirane);(2R)-propane-1,2-diol;hydrate (PubChem CID 159169454) has the molecular formula C9H22O5 and a molecular weight of 210.27 g/mol. Its IUPAC name is bis(2-methyloxirane);(2R)-propane-1,2-diol;hydrate.
| Compound Name | bis(2-methyloxirane);(2R)-propane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 159169454 |
| Molecular Formula | C9H22O5 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | bis(2-methyloxirane);(2R)-propane-1,2-diol;hydrate |
| SMILES | CC1CO1.CC1CO1.C[C@@H](O)CO.O |
| InChI | InChI=1S/C3H8O2.2C3H6O.H2O/c1-3(5)2-4;2*1-3-2-4-3;/h3-5H,2H2,1H3;2*3H,2H2,1H3;1H2/t3-;;;/m1.../s1 |
| InChIKey | PTGYZMKXRRTOGQ-HKYUIQSLSA-N |
| XLogP | -0.65 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|