C11H24O8 — CID 174373260
hexane-1,2,3,4,5,6-hexol;2-methyloxirane;oxirane (PubChem CID 174373260) has the molecular formula C11H24O8 and a molecular weight of 284.31 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;2-methyloxirane;oxirane.
| Compound Name | hexane-1,2,3,4,5,6-hexol;2-methyloxirane;oxirane |
|---|---|
| PubChem CID | 174373260 |
| Molecular Formula | C11H24O8 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O6.C3H6O.C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-2-4-3;1-2-3-1/h3-12H,1-2H2;3H,2H2,1H3;1-2H2 |
| InChIKey | GCVSUBDWSUOALB-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|