C8H18O6 — CID 174854855
3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane (PubChem CID 174854855) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane.
| Compound Name | 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane |
|---|---|
| PubChem CID | 174854855 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.OCC(O)COO |
| InChI | InChI=1S/C3H8O4.C3H6O.C2H4O/c4-1-3(5)2-7-6;1-3-2-4-3;1-2-3-1/h3-6H,1-2H2;3H,2H2,1H3;1-2H2 |
| InChIKey | QSRKSDRZZUBDOC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|