About 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane
3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane (PubChem CID 174854855) has the molecular formula C8H18O6
and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane.
Molecular Properties
| Compound Name | 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane |
| PubChem CID | 174854855 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.OCC(O)COO |
| InChI | InChI=1S/C3H8O4.C3H6O.C2H4O/c4-1-3(5)2-7-6;1-3-2-4-3;1-2-3-1/h3-6H,1-2H2;3H,2H2,1H3;1-2H2 |
| InChIKey | QSRKSDRZZUBDOC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane?
The IUPAC name of 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane (CID 174854855) is 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane.
What is the SMILES notation for 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane?
The canonical SMILES for 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane is C1CO1.CC1CO1.OCC(O)COO.
What is the InChIKey of 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane?
The InChIKey is QSRKSDRZZUBDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O4.C3H6O.C2H4O/c4-1-3(5)2-7-6;1-3-2-4-3;1-2-3-1/h3-6H,1-2H2;3H,2H2,1H3;1-2H2.
What are the key properties of 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane?
3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane has a molecular weight of 210.23 g/mol, XLogP of -0.75, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroperoxypropane-1,2-diol;2-methyloxirane;oxirane is sourced from PubChem (CID 174854855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).