C10H22O7 — CID 155092392
methanol;2-(oxetan-2-yloxy)oxetane;propane-1,2,3-triol (PubChem CID 155092392) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is methanol;2-(oxetan-2-yloxy)oxetane;propane-1,2,3-triol.
| Compound Name | methanol;2-(oxetan-2-yloxy)oxetane;propane-1,2,3-triol |
|---|---|
| PubChem CID | 155092392 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | methanol;2-(oxetan-2-yloxy)oxetane;propane-1,2,3-triol |
| SMILES | C1CC(OC2CCO2)O1.CO.OCC(O)CO |
| InChI | InChI=1S/C6H10O3.C3H8O3.CH4O/c1-3-7-5(1)9-6-2-4-8-6;4-1-3(6)2-5;1-2/h5-6H,1-4H2;3-6H,1-2H2;2H,1H3 |
| InChIKey | ONZPARCZWYTQDS-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |