C11H24O5 — CID 6451422
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methyloxirane;oxirane (PubChem CID 6451422) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methyloxirane;oxirane.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methyloxirane;oxirane |
|---|---|
| PubChem CID | 6451422 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.CCC(CO)(CO)CO |
| InChI | InChI=1S/C6H14O3.C3H6O.C2H4O/c1-2-6(3-7,4-8)5-9;1-3-2-4-3;1-2-3-1/h7-9H,2-5H2,1H3;3H,2H2,1H3;1-2H2 |
| InChIKey | YTZRFUSYPGFDNC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|