About 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane (PubChem CID 157089919) has the molecular formula C15H32O6
and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane.
Molecular Properties
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane |
| PubChem CID | 157089919 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane |
| SMILES | C1COC1.CCC(CO)(CO)CO.CCC1(CO)COC1 |
| InChI | InChI=1S/C6H14O3.C6H12O2.C3H6O/c1-2-6(3-7,4-8)5-9;1-2-6(3-7)4-8-5-6;1-2-4-3-1/h7-9H,2-5H2,1H3;7H,2-5H2,1H3;1-3H2 |
| InChIKey | AENVAJDZRFZOIK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane?
The IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane (CID 157089919) is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane.
What is the SMILES notation for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane?
The canonical SMILES for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane is C1COC1.CCC(CO)(CO)CO.CCC1(CO)COC1.
What is the InChIKey of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane?
The InChIKey is AENVAJDZRFZOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C6H12O2.C3H6O/c1-2-6(3-7,4-8)5-9;1-2-6(3-7)4-8-5-6;1-2-4-3-1/h7-9H,2-5H2,1H3;7H,2-5H2,1H3;1-3H2.
What are the key properties of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane?
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane has a molecular weight of 308.42 g/mol, XLogP of 0.17, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(3-ethyloxetan-3-yl)methanol;oxetane is sourced from PubChem (CID 157089919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).