C9H19ClO7 — CID 174844944
2-(chloromethyl)oxirane;3-(2,3-dihydroxypropylperoxy)propane-1,2-diol (PubChem CID 174844944) has the molecular formula C9H19ClO7 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;3-(2,3-dihydroxypropylperoxy)propane-1,2-diol.
| Compound Name | 2-(chloromethyl)oxirane;3-(2,3-dihydroxypropylperoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 174844944 |
| Molecular Formula | C9H19ClO7 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(chloromethyl)oxirane;3-(2,3-dihydroxypropylperoxy)propane-1,2-diol |
| SMILES | ClCC1CO1.OCC(O)COOCC(O)CO |
| InChI | InChI=1S/C6H14O6.C3H5ClO/c7-1-5(9)3-11-12-4-6(10)2-8;4-1-3-2-5-3/h5-10H,1-4H2;3H,1-2H2 |
| InChIKey | ATBJVDHOQSUHPX-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|