C9H19ClO3S4 — CID 157179877
1,3-bis(sulfanyl)propan-2-ol;2-(chloromethyl)oxirane;dithiolan-4-ol (PubChem CID 157179877) has the molecular formula C9H19ClO3S4 and a molecular weight of 338.97 g/mol. Its IUPAC name is 1,3-bis(sulfanyl)propan-2-ol;2-(chloromethyl)oxirane;dithiolan-4-ol.
| Compound Name | 1,3-bis(sulfanyl)propan-2-ol;2-(chloromethyl)oxirane;dithiolan-4-ol |
|---|---|
| PubChem CID | 157179877 |
| Molecular Formula | C9H19ClO3S4 |
| Molecular Weight | 338.97 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 1,3-bis(sulfanyl)propan-2-ol;2-(chloromethyl)oxirane;dithiolan-4-ol |
| SMILES | ClCC1CO1.OC(CS)CS.OC1CSSC1 |
| InChI | InChI=1S/C3H5ClO.C3H6OS2.C3H8OS2/c4-1-3-2-5-3;4-3-1-5-6-2-3;4-3(1-5)2-6/h3H,1-2H2;3-4H,1-2H2;3-6H,1-2H2 |
| InChIKey | AOLGDQGMWCYUQA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.97 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|