C12H24O4S8 — CID 102163953
1,2,6,7,11,12,16,17-octathiacycloicosane-4,9,14,19-tetrol (PubChem CID 102163953) has the molecular formula C12H24O4S8 and a molecular weight of 488.86 g/mol. Its IUPAC name is 1,2,6,7,11,12,16,17-octathiacycloicosane-4,9,14,19-tetrol.
| Compound Name | 1,2,6,7,11,12,16,17-octathiacycloicosane-4,9,14,19-tetrol |
|---|---|
| PubChem CID | 102163953 |
| Molecular Formula | C12H24O4S8 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | 1,2,6,7,11,12,16,17-octathiacycloicosane-4,9,14,19-tetrol |
| SMILES | OC1CSSCC(O)CSSCC(O)CSSCC(O)CSSC1 |
| InChI | InChI=1S/C12H24O4S8/c13-9-1-17-18-3-10(14)4-21-22-7-12(16)8-24-23-6-11(15)5-20-19-2-9/h9-16H,1-8H2 |
| InChIKey | ZTTVBVYURKHFBD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|