C18H30S6 — CID 140828516
5,6,14,15,20,21-hexathiatetracyclo[8.8.4.13,17.18,12]tetracosane (PubChem CID 140828516) has the molecular formula C18H30S6 and a molecular weight of 438.84 g/mol. Its IUPAC name is 5,6,14,15,20,21-hexathiatetracyclo[8.8.4.13,17.18,12]tetracosane.
| Compound Name | 5,6,14,15,20,21-hexathiatetracyclo[8.8.4.13,17.18,12]tetracosane |
|---|---|
| PubChem CID | 140828516 |
| Molecular Formula | C18H30S6 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 5,6,14,15,20,21-hexathiatetracyclo[8.8.4.13,17.18,12]tetracosane |
| SMILES | C1SSCC2CC3CSSCC4CC1CC(CSSCC(C2)C3)C4 |
| InChI | InChI=1S/C18H30S6/c1-13-2-15-3-14(1)8-20-22-11-17-4-16(10-21-19-7-13)5-18(6-17)12-24-23-9-15/h13-18H,1-12H2 |
| InChIKey | MTPHMFBVQUKUII-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|