About adamantane;hydrate
adamantane;hydrate (PubChem CID 137498586) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is adamantane;hydrate.
Molecular Properties
| Compound Name | adamantane;hydrate |
| PubChem CID | 137498586 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | adamantane;hydrate |
| SMILES | C1C2CC3CC1CC(C2)C3.O |
| InChI | InChI=1S/C10H16.H2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H2 |
| InChIKey | GOMNIPUCUILKME-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;hydrate?
The IUPAC name of adamantane;hydrate (CID 137498586) is adamantane;hydrate.
What is the SMILES notation for adamantane;hydrate?
The canonical SMILES for adamantane;hydrate is C1C2CC3CC1CC(C2)C3.O.
What is the InChIKey of adamantane;hydrate?
The InChIKey is GOMNIPUCUILKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.H2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H2.
What are the key properties of adamantane;hydrate?
adamantane;hydrate has a molecular weight of 154.25 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;hydrate is sourced from PubChem (CID 137498586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).