About adamantane;hydrogen peroxide
adamantane;hydrogen peroxide (PubChem CID 159706724) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is adamantane;hydrogen peroxide.
Molecular Properties
| Compound Name | adamantane;hydrogen peroxide |
| PubChem CID | 159706724 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | adamantane;hydrogen peroxide |
| SMILES | C1C2CC3CC1CC(C2)C3.OO |
| InChI | InChI=1S/C10H16.H2O2/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2/h7-10H,1-6H2;1-2H |
| InChIKey | MYHPJAICVFKMKP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze adamantane;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;hydrogen peroxide?
The IUPAC name of adamantane;hydrogen peroxide (CID 159706724) is adamantane;hydrogen peroxide.
What is the SMILES notation for adamantane;hydrogen peroxide?
The canonical SMILES for adamantane;hydrogen peroxide is C1C2CC3CC1CC(C2)C3.OO.
What is the InChIKey of adamantane;hydrogen peroxide?
The InChIKey is MYHPJAICVFKMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.H2O2/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2/h7-10H,1-6H2;1-2H.
What are the key properties of adamantane;hydrogen peroxide?
adamantane;hydrogen peroxide has a molecular weight of 170.25 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;hydrogen peroxide is sourced from PubChem (CID 159706724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).