About azanium;adamantane;hydroxide
azanium;adamantane;hydroxide (PubChem CID 139557020) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is azanium;adamantane;hydroxide.
Molecular Properties
| Compound Name | azanium;adamantane;hydroxide |
| PubChem CID | 139557020 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | azanium;adamantane;hydroxide |
| SMILES | C1C2CC3CC1CC(C2)C3.[NH4+].[OH-] |
| InChI | InChI=1S/C10H16.H3N.H2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h7-10H,1-6H2;1H3;1H2 |
| InChIKey | WXYROFYBQRRCEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azanium;adamantane;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;adamantane;hydroxide?
The IUPAC name of azanium;adamantane;hydroxide (CID 139557020) is azanium;adamantane;hydroxide.
What is the SMILES notation for azanium;adamantane;hydroxide?
The canonical SMILES for azanium;adamantane;hydroxide is C1C2CC3CC1CC(C2)C3.[NH4+].[OH-].
What is the InChIKey of azanium;adamantane;hydroxide?
The InChIKey is WXYROFYBQRRCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.H3N.H2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h7-10H,1-6H2;1H3;1H2.
What are the key properties of azanium;adamantane;hydroxide?
azanium;adamantane;hydroxide has a molecular weight of 171.28 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;adamantane;hydroxide is sourced from PubChem (CID 139557020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).