About adamantane;N-methylmethanamine
adamantane;N-methylmethanamine (PubChem CID 20975909) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is adamantane;N-methylmethanamine.
Molecular Properties
| Compound Name | adamantane;N-methylmethanamine |
| PubChem CID | 20975909 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | adamantane;N-methylmethanamine |
| SMILES | C1C2CC3CC1CC(C2)C3.CNC |
| InChI | InChI=1S/C10H16.C2H7N/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-2/h7-10H,1-6H2;3H,1-2H3 |
| InChIKey | ZJZPAQKACHYQON-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantane;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;N-methylmethanamine?
The IUPAC name of adamantane;N-methylmethanamine (CID 20975909) is adamantane;N-methylmethanamine.
What is the SMILES notation for adamantane;N-methylmethanamine?
The canonical SMILES for adamantane;N-methylmethanamine is C1C2CC3CC1CC(C2)C3.CNC.
What is the InChIKey of adamantane;N-methylmethanamine?
The InChIKey is ZJZPAQKACHYQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C2H7N/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-2/h7-10H,1-6H2;3H,1-2H3.
What are the key properties of adamantane;N-methylmethanamine?
adamantane;N-methylmethanamine has a molecular weight of 181.32 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;N-methylmethanamine is sourced from PubChem (CID 20975909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).