About adamantane;methane;methanol
adamantane;methane;methanol (PubChem CID 174446810) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is adamantane;methane;methanol.
Molecular Properties
| Compound Name | adamantane;methane;methanol |
| PubChem CID | 174446810 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | adamantane;methane;methanol |
| SMILES | C.C1C2CC3CC1CC(C2)C3.CO |
| InChI | InChI=1S/C10H16.CH4O.CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2;/h7-10H,1-6H2;2H,1H3;1H4 |
| InChIKey | AFEYVJJJPTUJPA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantane;methane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;methane;methanol?
The IUPAC name of adamantane;methane;methanol (CID 174446810) is adamantane;methane;methanol.
What is the SMILES notation for adamantane;methane;methanol?
The canonical SMILES for adamantane;methane;methanol is C.C1C2CC3CC1CC(C2)C3.CO.
What is the InChIKey of adamantane;methane;methanol?
The InChIKey is AFEYVJJJPTUJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.CH4O.CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2;/h7-10H,1-6H2;2H,1H3;1H4.
What are the key properties of adamantane;methane;methanol?
adamantane;methane;methanol has a molecular weight of 184.32 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;methane;methanol is sourced from PubChem (CID 174446810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).