About adamantane;azane;trihydrochloride
adamantane;azane;trihydrochloride (PubChem CID 172754322) has the molecular formula C10H22Cl3N
and a molecular weight of 262.65 g/mol. Its IUPAC name is adamantane;azane;trihydrochloride.
Molecular Properties
| Compound Name | adamantane;azane;trihydrochloride |
| PubChem CID | 172754322 |
| Molecular Formula | C10H22Cl3N |
| Molecular Weight | 262.65 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | adamantane;azane;trihydrochloride |
| SMILES | C1C2CC3CC1CC(C2)C3.Cl.Cl.Cl.N |
| InChI | InChI=1S/C10H16.3ClH.H3N/c1-7-2-9-4-8(1)5-10(3-7)6-9;;;;/h7-10H,1-6H2;3*1H;1H3 |
| InChIKey | KUQGSYKXVGRNDA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantane;azane;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;azane;trihydrochloride?
The IUPAC name of adamantane;azane;trihydrochloride (CID 172754322) is adamantane;azane;trihydrochloride.
What is the SMILES notation for adamantane;azane;trihydrochloride?
The canonical SMILES for adamantane;azane;trihydrochloride is C1C2CC3CC1CC(C2)C3.Cl.Cl.Cl.N.
What is the InChIKey of adamantane;azane;trihydrochloride?
The InChIKey is KUQGSYKXVGRNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.3ClH.H3N/c1-7-2-9-4-8(1)5-10(3-7)6-9;;;;/h7-10H,1-6H2;3*1H;1H3.
What are the key properties of adamantane;azane;trihydrochloride?
adamantane;azane;trihydrochloride has a molecular weight of 262.65 g/mol, XLogP of 4.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;azane;trihydrochloride is sourced from PubChem (CID 172754322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).