C9H16OS2 — CID 22891774
1,5-dithiaspiro[5.5]undecan-3-ol (PubChem CID 22891774) has the molecular formula C9H16OS2 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1,5-dithiaspiro[5.5]undecan-3-ol.
| Compound Name | 1,5-dithiaspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 22891774 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1,5-dithiaspiro[5.5]undecan-3-ol |
| SMILES | OC1CSC2(CCCCC2)SC1 |
| InChI | InChI=1S/C9H16OS2/c10-8-6-11-9(12-7-8)4-2-1-3-5-9/h8,10H,1-7H2 |
| InChIKey | VFHWAYNNNASFAM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |