C9H18O3 — CID 11816153
1-(hydroxymethyl)cyclooctane-1,5-diol (PubChem CID 11816153) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(hydroxymethyl)cyclooctane-1,5-diol.
| Compound Name | 1-(hydroxymethyl)cyclooctane-1,5-diol |
|---|---|
| PubChem CID | 11816153 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1-(hydroxymethyl)cyclooctane-1,5-diol |
| SMILES | OCC1(O)CCCC(O)CCC1 |
| InChI | InChI=1S/C9H18O3/c10-7-9(12)5-1-3-8(11)4-2-6-9/h8,10-12H,1-7H2 |
| InChIKey | XGIJCPWAZUWKSM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |