C12H20OS2 — CID 10243572
(2S,4S,6S)-2-prop-2-enyl-1,7-dithiaspiro[5.5]undecan-4-ol (PubChem CID 10243572) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is (2S,4S,6S)-2-prop-2-enyl-1,7-dithiaspiro[5.5]undecan-4-ol.
| Compound Name | (2S,4S,6S)-2-prop-2-enyl-1,7-dithiaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 10243572 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2S,4S,6S)-2-prop-2-enyl-1,7-dithiaspiro[5.5]undecan-4-ol |
| SMILES | C=CC[C@H]1C[C@H](O)C[C@]2(CCCCS2)S1 |
| InChI | InChI=1S/C12H20OS2/c1-2-5-11-8-10(13)9-12(15-11)6-3-4-7-14-12/h2,10-11,13H,1,3-9H2/t10-,11-,12-/m0/s1 |
| InChIKey | NMIBJMUKRPIEOE-SRVKXCTJSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|