C11H18O — CID 10702229
trans-(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexan-1-ol (PubChem CID 10702229) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is trans-(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10702229 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | trans-(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@H]1CCCC[C@]1(O)C=C |
| InChI | InChI=1S/C11H18O/c1-3-7-10-8-5-6-9-11(10,12)4-2/h3-4,10,12H,1-2,5-9H2/t10-,11+/m0/s1 |
| InChIKey | YBXRREKCKRAWAQ-WDEREUQCSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|