C19H36OSi — CID 10881406
trans-(1R,2R)-1-ethenyl-2-(1-tripropylsilylethenyl)cyclohexan-1-ol (PubChem CID 10881406) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethenyl-2-(1-tripropylsilylethenyl)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-1-ethenyl-2-(1-tripropylsilylethenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10881406 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | trans-(1R,2R)-1-ethenyl-2-(1-tripropylsilylethenyl)cyclohexan-1-ol |
| SMILES | C=C[C@]1(O)CCCC[C@H]1C(=C)[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C19H36OSi/c1-6-14-21(15-7-2,16-8-3)17(5)18-12-10-11-13-19(18,20)9-4/h9,18,20H,4-8,10-16H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | WWTZPFURNAMDTJ-OALUTQOASA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|