C16H26O2 — CID 174583937
1-cyclohexyl-2-prop-2-enylcyclohexane-1-carboxylic acid (PubChem CID 174583937) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-cyclohexyl-2-prop-2-enylcyclohexane-1-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-prop-2-enylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174583937 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-cyclohexyl-2-prop-2-enylcyclohexane-1-carboxylic acid |
| SMILES | C=CCC1CCCCC1(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C16H26O2/c1-2-8-13-11-6-7-12-16(13,15(17)18)14-9-4-3-5-10-14/h2,13-14H,1,3-12H2,(H,17,18) |
| InChIKey | ONVLMKBSOYPXCT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|