About 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid
1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid (PubChem CID 70579578) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 70579578 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid |
| SMILES | C=CCC1(CC=C)CCC(C2(C(=O)O)CCCCC2)CC1 |
| InChI | InChI=1S/C19H30O2/c1-3-10-18(11-4-2)14-8-16(9-15-18)19(17(20)21)12-6-5-7-13-19/h3-4,16H,1-2,5-15H2,(H,20,21) |
| InChIKey | CDGROVASFYNKIC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid (CID 70579578) is 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid is C=CCC1(CC=C)CCC(C2(C(=O)O)CCCCC2)CC1.
What is the InChIKey of 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid?
The InChIKey is CDGROVASFYNKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-3-10-18(11-4-2)14-8-16(9-15-18)19(17(20)21)12-6-5-7-13-19/h3-4,16H,1-2,5-15H2,(H,20,21).
What are the key properties of 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid?
1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid has a molecular weight of 290.45 g/mol, XLogP of 5.35, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4-bis(prop-2-enyl)cyclohexyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 70579578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).