C10H16O4S — CID 82619742
1-(1,1-dioxothian-4-yl)cyclobutane-1-carboxylic acid (PubChem CID 82619742) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(1,1-dioxothian-4-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 82619742 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C2CCS(=O)(=O)CC2)CCC1 |
| InChI | InChI=1S/C10H16O4S/c11-9(12)10(4-1-5-10)8-2-6-15(13,14)7-3-8/h8H,1-7H2,(H,11,12) |
| InChIKey | AHNMNBKMBYUPGW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |