C13H22O4S — CID 80610840
1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid (PubChem CID 80610840) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 80610840 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid |
| SMILES | O=C(O)C1(C2CCS(=O)(=O)C2)CCCCCCC1 |
| InChI | InChI=1S/C13H22O4S/c14-12(15)13(7-4-2-1-3-5-8-13)11-6-9-18(16,17)10-11/h11H,1-10H2,(H,14,15) |
| InChIKey | RTKZKKYXPKEJAX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |