1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid

C13H22O4S — CID 80610840

IUPAC1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid
SMILESO=C(O)C1(C2CCS(=O)(=O)C2)CCCCCCC1
InChIInChI=1S/C13H22O4S/c14-12(15)13(7-4-2-1-3-5-8-13)11-6-9-18(16,17)10-11/h11H,1-10H2,(H,14,15)
InChIKeyRTKZKKYXPKEJAX-UHFFFAOYSA-N
MW274.38 g/mol
LogP2.24
Rot. Bonds2

About 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid

1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid (PubChem CID 80610840) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid.

Molecular Properties

Compound Name1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid
PubChem CID80610840
Molecular FormulaC13H22O4S
Molecular Weight274.38 g/mol
Exact Mass274.12
IUPAC Name1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid
SMILESO=C(O)C1(C2CCS(=O)(=O)C2)CCCCCCC1
InChIInChI=1S/C13H22O4S/c14-12(15)13(7-4-2-1-3-5-8-13)11-6-9-18(16,17)10-11/h11H,1-10H2,(H,14,15)
InChIKeyRTKZKKYXPKEJAX-UHFFFAOYSA-N
XLogP2.24
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.38
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid (CID 80610840) is 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid is O=C(O)C1(C2CCS(=O)(=O)C2)CCCCCCC1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid?
The InChIKey is RTKZKKYXPKEJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S/c14-12(15)13(7-4-2-1-3-5-8-13)11-6-9-18(16,17)10-11/h11H,1-10H2,(H,14,15).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid?
1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid has a molecular weight of 274.38 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)cyclooctane-1-carboxylic acid is sourced from PubChem (CID 80610840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).