1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid

C17H30O2 — CID 80611832

IUPAC1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid
SMILESCC1CC(C)CC(C2(C(=O)O)CCCCCCC2)C1
InChIInChI=1S/C17H30O2/c1-13-10-14(2)12-15(11-13)17(16(18)19)8-6-4-3-5-7-9-17/h13-15H,3-12H2,1-2H3,(H,18,19)
InChIKeyBNCFLOLKLDRTJX-UHFFFAOYSA-N
MW266.42 g/mol
LogP4.87
Rot. Bonds2

About 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid

1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid (PubChem CID 80611832) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid.

Molecular Properties

Compound Name1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid
PubChem CID80611832
Molecular FormulaC17H30O2
Molecular Weight266.42 g/mol
Exact Mass266.22
IUPAC Name1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid
SMILESCC1CC(C)CC(C2(C(=O)O)CCCCCCC2)C1
InChIInChI=1S/C17H30O2/c1-13-10-14(2)12-15(11-13)17(16(18)19)8-6-4-3-5-7-9-17/h13-15H,3-12H2,1-2H3,(H,18,19)
InChIKeyBNCFLOLKLDRTJX-UHFFFAOYSA-N
XLogP4.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.42
LogP ≤ 54.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid?
The IUPAC name of 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid (CID 80611832) is 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid.
What is the SMILES notation for 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid?
The canonical SMILES for 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid is CC1CC(C)CC(C2(C(=O)O)CCCCCCC2)C1.
What is the InChIKey of 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid?
The InChIKey is BNCFLOLKLDRTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-13-10-14(2)12-15(11-13)17(16(18)19)8-6-4-3-5-7-9-17/h13-15H,3-12H2,1-2H3,(H,18,19).
What are the key properties of 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid?
1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid has a molecular weight of 266.42 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid is sourced from PubChem (CID 80611832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).