C17H30O2 — CID 80611832
1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid (PubChem CID 80611832) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid.
| Compound Name | 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 80611832 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)cyclooctane-1-carboxylic acid |
| SMILES | CC1CC(C)CC(C2(C(=O)O)CCCCCCC2)C1 |
| InChI | InChI=1S/C17H30O2/c1-13-10-14(2)12-15(11-13)17(16(18)19)8-6-4-3-5-7-9-17/h13-15H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | BNCFLOLKLDRTJX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |