About 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid
1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 82235039) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid.
Analyze 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid (CID 82235039) is 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid is CC1CC(C)CN(C2(C(=O)O)CCCC2)C1.
What is the InChIKey of 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid?
The InChIKey is OZFXNCKXHBMWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-10-7-11(2)9-14(8-10)13(12(15)16)5-3-4-6-13/h10-11H,3-9H2,1-2H3,(H,15,16).
What are the key properties of 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid?
1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid has a molecular weight of 225.33 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpiperidin-1-yl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 82235039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).