1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid

C11H19NO2 — CID 79695154

IUPAC1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid
SMILESCC1(C)CN(C2(C(=O)O)CCCC2)C1
InChIInChI=1S/C11H19NO2/c1-10(2)7-12(8-10)11(9(13)14)5-3-4-6-11/h3-8H2,1-2H3,(H,13,14)
InChIKeyJVNNUAQWYBBYIZ-UHFFFAOYSA-N
MW197.28 g/mol
LogP1.73
Rot. Bonds2

About 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid

1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 79695154) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid
PubChem CID79695154
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Name1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid
SMILESCC1(C)CN(C2(C(=O)O)CCCC2)C1
InChIInChI=1S/C11H19NO2/c1-10(2)7-12(8-10)11(9(13)14)5-3-4-6-11/h3-8H2,1-2H3,(H,13,14)
InChIKeyJVNNUAQWYBBYIZ-UHFFFAOYSA-N
XLogP1.73
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid (CID 79695154) is 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid is CC1(C)CN(C2(C(=O)O)CCCC2)C1.
What is the InChIKey of 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid?
The InChIKey is JVNNUAQWYBBYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-10(2)7-12(8-10)11(9(13)14)5-3-4-6-11/h3-8H2,1-2H3,(H,13,14).
What are the key properties of 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid?
1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid has a molecular weight of 197.28 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylazetidin-1-yl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 79695154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).