C11H20O3S — CID 115073913
1-(1,1-dioxothian-3-yl)cyclohexan-1-ol (PubChem CID 115073913) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)cyclohexan-1-ol.
| Compound Name | 1-(1,1-dioxothian-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 115073913 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)cyclohexan-1-ol |
| SMILES | O=S1(=O)CCCC(C2(O)CCCCC2)C1 |
| InChI | InChI=1S/C11H20O3S/c12-11(6-2-1-3-7-11)10-5-4-8-15(13,14)9-10/h10,12H,1-9H2 |
| InChIKey | AIPGAJHJMJCXNS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |