C9H16O — CID 102059632
(3aS)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 102059632) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3aS)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (3aS)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 102059632 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3aS)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | O[C@]12CCCCC1CCC2 |
| InChI | InChI=1S/C9H16O/c10-9-6-2-1-4-8(9)5-3-7-9/h8,10H,1-7H2/t8?,9-/m0/s1 |
| InChIKey | KMGJVGCSNRGWHH-GKAPJAKFSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |