C10H18O — CID 101060141
(2S,3aR,7aR)-2-methyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 101060141) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2S,3aR,7aR)-2-methyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (2S,3aR,7aR)-2-methyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 101060141 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2S,3aR,7aR)-2-methyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | C[C@H]1C[C@H]2CCCC[C@@]2(O)C1 |
| InChI | InChI=1S/C10H18O/c1-8-6-9-4-2-3-5-10(9,11)7-8/h8-9,11H,2-7H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | MBAPSJYZVBYTRW-IVZWLZJFSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |