C10H18O3S — CID 63162854
3-cyclohexyl-1,1-dioxothiolan-3-ol (PubChem CID 63162854) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-dioxothiolan-3-ol.
| Compound Name | 3-cyclohexyl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 63162854 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-cyclohexyl-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(C2CCCCC2)C1 |
| InChI | InChI=1S/C10H18O3S/c11-10(6-7-14(12,13)8-10)9-4-2-1-3-5-9/h9,11H,1-8H2 |
| InChIKey | PBUXPMQAJLUQHD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |