C10H15NO4S — CID 115045580
3-(1,1-dioxothian-3-yl)-3-isocyanatocyclobutan-1-ol (PubChem CID 115045580) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-3-isocyanatocyclobutan-1-ol.
| Compound Name | 3-(1,1-dioxothian-3-yl)-3-isocyanatocyclobutan-1-ol |
|---|---|
| PubChem CID | 115045580 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-3-isocyanatocyclobutan-1-ol |
| SMILES | O=C=NC1(C2CCCS(=O)(=O)C2)CC(O)C1 |
| InChI | InChI=1S/C10H15NO4S/c12-7-11-10(4-9(13)5-10)8-2-1-3-16(14,15)6-8/h8-9,13H,1-6H2 |
| InChIKey | PKWCDUMBSCPYLI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|