C13H22N2O — CID 115033603
4-(1-isocyanato-3,3-dimethylcyclobutyl)-1-methylpiperidine (PubChem CID 115033603) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-(1-isocyanato-3,3-dimethylcyclobutyl)-1-methylpiperidine.
| Compound Name | 4-(1-isocyanato-3,3-dimethylcyclobutyl)-1-methylpiperidine |
|---|---|
| PubChem CID | 115033603 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-(1-isocyanato-3,3-dimethylcyclobutyl)-1-methylpiperidine |
| SMILES | CN1CCC(C2(N=C=O)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C13H22N2O/c1-12(2)8-13(9-12,14-10-16)11-4-6-15(3)7-5-11/h11H,4-9H2,1-3H3 |
| InChIKey | NCKOJEYMGKMCMV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|